C21H31N3O2S — CID 55849054
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 55849054) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55849054 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-4-methyl-2-(5-methylfuran-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccc(-c2nc(C)c(C(=O)NCCCCN3CC(C)CC(C)C3)s2)o1 |
| InChI | InChI=1S/C21H31N3O2S/c1-14-11-15(2)13-24(12-14)10-6-5-9-22-20(25)19-17(4)23-21(27-19)18-8-7-16(3)26-18/h7-8,14-15H,5-6,9-13H2,1-4H3,(H,22,25) |
| InChIKey | LXOUMSAFVCOCAD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|