C16H16ClN3O3S — CID 55850231
N-(4-chloro-2-nitrophenyl)-2-(2-thiophen-3-ylpyrrolidin-1-yl)acetamide (PubChem CID 55850231) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-(2-thiophen-3-ylpyrrolidin-1-yl)acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-(2-thiophen-3-ylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55850231 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-(2-thiophen-3-ylpyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1c1ccsc1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClN3O3S/c17-12-3-4-13(15(8-12)20(22)23)18-16(21)9-19-6-1-2-14(19)11-5-7-24-10-11/h3-5,7-8,10,14H,1-2,6,9H2,(H,18,21) |
| InChIKey | GUGNQZBPQDJKQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|