C19H22BrN3O3S — CID 55853377
5-bromo-N-methyl-N-[2-(2-methyl-4-morpholin-4-ylanilino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55853377) has the molecular formula C19H22BrN3O3S and a molecular weight of 452.37 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-(2-methyl-4-morpholin-4-ylanilino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-(2-methyl-4-morpholin-4-ylanilino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55853377 |
| Molecular Formula | C19H22BrN3O3S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-(2-methyl-4-morpholin-4-ylanilino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1NC(=O)CN(C)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C19H22BrN3O3S/c1-13-11-14(23-7-9-26-10-8-23)3-4-15(13)21-18(24)12-22(2)19(25)16-5-6-17(20)27-16/h3-6,11H,7-10,12H2,1-2H3,(H,21,24) |
| InChIKey | ZULDQHOXQRALKE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|