C20H34N10O3S — CID 55854091
2-[4-[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 55854091) has the molecular formula C20H34N10O3S and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[4-[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55854091 |
| Molecular Formula | C20H34N10O3S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[4-[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)N3CCN(CC(=O)NCCCOC)CC3)nnc2n1 |
| InChI | InChI=1S/C20H34N10O3S/c1-4-21-17-24-18(22-5-2)30-19(25-17)26-27-20(30)34-14-16(32)29-10-8-28(9-11-29)13-15(31)23-7-6-12-33-3/h4-14H2,1-3H3,(H,23,31)(H2,21,22,24,25,26) |
| InChIKey | MSNLBNDYAMYGHU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|