C21H30N8O2S — CID 55911528
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-(4-methylphenoxy)butyl]acetamide (PubChem CID 55911528) has the molecular formula C21H30N8O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-(4-methylphenoxy)butyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-(4-methylphenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 55911528 |
| Molecular Formula | C21H30N8O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-(4-methylphenoxy)butyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)NCCCCOc3ccc(C)cc3)nnc2n1 |
| InChI | InChI=1S/C21H30N8O2S/c1-4-22-18-25-19(23-5-2)29-20(26-18)27-28-21(29)32-14-17(30)24-12-6-7-13-31-16-10-8-15(3)9-11-16/h8-11H,4-7,12-14H2,1-3H3,(H,24,30)(H2,22,23,25,26,27) |
| InChIKey | HPOHQGYKSGFLSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|