C20H25N11OS — CID 55912047
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 55912047) has the molecular formula C20H25N11OS and a molecular weight of 467.56 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55912047 |
| Molecular Formula | C20H25N11OS |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)NCc3cccc(Cn4cncn4)c3)nnc2n1 |
| InChI | InChI=1S/C20H25N11OS/c1-3-22-17-26-18(23-4-2)31-19(27-17)28-29-20(31)33-11-16(32)24-9-14-6-5-7-15(8-14)10-30-13-21-12-25-30/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,24,32)(H2,22,23,26,27,28) |
| InChIKey | RYMOMQMDZHTSFX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|