C16H18BrN7OS — CID 18575196
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-(3-bromophenyl)ethanone (PubChem CID 18575196) has the molecular formula C16H18BrN7OS and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-(3-bromophenyl)ethanone.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-(3-bromophenyl)ethanone |
|---|---|
| PubChem CID | 18575196 |
| Molecular Formula | C16H18BrN7OS |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-(3-bromophenyl)ethanone |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)c3cccc(Br)c3)nnc2n1 |
| InChI | InChI=1S/C16H18BrN7OS/c1-3-18-13-20-14(19-4-2)24-15(21-13)22-23-16(24)26-9-12(25)10-6-5-7-11(17)8-10/h5-8H,3-4,9H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | QYSLODQLZSTNIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|