C16H26N8O2S — CID 2339973
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanone (PubChem CID 2339973) has the molecular formula C16H26N8O2S and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanone.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 2339973 |
| Molecular Formula | C16H26N8O2S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanone |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)N3C[C@H](C)O[C@@H](C)C3)nnc2n1 |
| InChI | InChI=1S/C16H26N8O2S/c1-5-17-13-19-14(18-6-2)24-15(20-13)21-22-16(24)27-9-12(25)23-7-10(3)26-11(4)8-23/h10-11H,5-9H2,1-4H3,(H2,17,18,19,20,21)/t10-,11-/m0/s1 |
| InChIKey | RZTCZFAGNUHLMY-QWRGUYRKSA-N |
| XLogP | 1.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|