C17H20F2N8OS2 — CID 55498715
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 55498715) has the molecular formula C17H20F2N8OS2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55498715 |
| Molecular Formula | C17H20F2N8OS2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)Nc3ccccc3SC(F)F)nnc2n1 |
| InChI | InChI=1S/C17H20F2N8OS2/c1-3-20-14-23-15(21-4-2)27-16(24-14)25-26-17(27)29-9-12(28)22-10-7-5-6-8-11(10)30-13(18)19/h5-8,13H,3-4,9H2,1-2H3,(H,22,28)(H2,20,21,23,24,25) |
| InChIKey | QDPGRMMLVQHWAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|