C20H28N8OS — CID 2339956
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-[(2R)-butan-2-yl]phenyl]acetamide (PubChem CID 2339956) has the molecular formula C20H28N8OS and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-[(2R)-butan-2-yl]phenyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-[(2R)-butan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 2339956 |
| Molecular Formula | C20H28N8OS |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[4-[(2R)-butan-2-yl]phenyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)Nc3ccc([C@H](C)CC)cc3)nnc2n1 |
| InChI | InChI=1S/C20H28N8OS/c1-5-13(4)14-8-10-15(11-9-14)23-16(29)12-30-20-27-26-19-25-17(21-6-2)24-18(22-7-3)28(19)20/h8-11,13H,5-7,12H2,1-4H3,(H,23,29)(H2,21,22,24,25,26)/t13-/m1/s1 |
| InChIKey | PIGTWKJUJUVDSS-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|