C20H24N8O5S — CID 55317659
dimethyl 5-[[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55317659) has the molecular formula C20H24N8O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is dimethyl 5-[[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55317659 |
| Molecular Formula | C20H24N8O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | dimethyl 5-[[2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)Nc3cc(C(=O)OC)cc(C(=O)OC)c3)nnc2n1 |
| InChI | InChI=1S/C20H24N8O5S/c1-5-21-17-24-18(22-6-2)28-19(25-17)26-27-20(28)34-10-14(29)23-13-8-11(15(30)32-3)7-12(9-13)16(31)33-4/h7-9H,5-6,10H2,1-4H3,(H,23,29)(H2,21,22,24,25,26) |
| InChIKey | ZDWDNQUKXOBIBP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|