C19H26N8O2S — CID 55954613
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(2-methylphenoxy)ethyl]acetamide (PubChem CID 55954613) has the molecular formula C19H26N8O2S and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(2-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(2-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55954613 |
| Molecular Formula | C19H26N8O2S |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[2-(2-methylphenoxy)ethyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)NCCOc3ccccc3C)nnc2n1 |
| InChI | InChI=1S/C19H26N8O2S/c1-4-20-16-23-17(21-5-2)27-18(24-16)25-26-19(27)30-12-15(28)22-10-11-29-14-9-7-6-8-13(14)3/h6-9H,4-5,10-12H2,1-3H3,(H,22,28)(H2,20,21,23,24,25) |
| InChIKey | LODLSQJJIQHJDN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|