C19H23N11OS — CID 55856817
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[(6-imidazol-1-yl-3-pyridinyl)methyl]acetamide (PubChem CID 55856817) has the molecular formula C19H23N11OS and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[(6-imidazol-1-yl-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[(6-imidazol-1-yl-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 55856817 |
| Molecular Formula | C19H23N11OS |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[(6-imidazol-1-yl-3-pyridinyl)methyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)NCc3ccc(-n4ccnc4)nc3)nnc2n1 |
| InChI | InChI=1S/C19H23N11OS/c1-3-21-16-25-17(22-4-2)30-18(26-16)27-28-19(30)32-11-15(31)24-10-13-5-6-14(23-9-13)29-8-7-20-12-29/h5-9,12H,3-4,10-11H2,1-2H3,(H,24,31)(H2,21,22,25,26,27) |
| InChIKey | GQQUBKUGGLKCCA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|