C19H24N10O2S — CID 55865345
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide (PubChem CID 55865345) has the molecular formula C19H24N10O2S and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55865345 |
| Molecular Formula | C19H24N10O2S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-[3-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)Nc3cccc(N4CCNC4=O)c3)nnc2n1 |
| InChI | InChI=1S/C19H24N10O2S/c1-3-20-15-24-16(21-4-2)29-17(25-15)26-27-19(29)32-11-14(30)23-12-6-5-7-13(10-12)28-9-8-22-18(28)31/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,22,31)(H,23,30)(H2,20,21,24,25,26) |
| InChIKey | UYRMAMBEXAZIDI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|