C20H20FN5O3S — CID 55855640
1-(5-fluoroquinazolin-4-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 55855640) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-(5-fluoroquinazolin-4-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-fluoroquinazolin-4-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55855640 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-(5-fluoroquinazolin-4-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(c3ncnc4cccc(F)c34)CC2)cc1 |
| InChI | InChI=1S/C20H20FN5O3S/c21-16-2-1-3-17-18(16)19(24-12-23-17)26-10-8-13(9-11-26)20(27)25-14-4-6-15(7-5-14)30(22,28)29/h1-7,12-13H,8-11H2,(H,25,27)(H2,22,28,29) |
| InChIKey | VLFYFFUVEOVZJW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |