C19H23F2N3O3S — CID 55862793
4-(butan-2-ylsulfamoyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]benzamide (PubChem CID 55862793) has the molecular formula C19H23F2N3O3S and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-(butan-2-ylsulfamoyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]benzamide.
| Compound Name | 4-(butan-2-ylsulfamoyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]benzamide |
|---|---|
| PubChem CID | 55862793 |
| Molecular Formula | C19H23F2N3O3S |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-(butan-2-ylsulfamoyl)-N-[4-(dimethylamino)-3,5-difluorophenyl]benzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)Nc2cc(F)c(N(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C19H23F2N3O3S/c1-5-12(2)23-28(26,27)15-8-6-13(7-9-15)19(25)22-14-10-16(20)18(24(3)4)17(21)11-14/h6-12,23H,5H2,1-4H3,(H,22,25) |
| InChIKey | NLXGJEYEOBODHO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|