C17H14N4O3S — CID 55867483
2-(4-cyanophenoxy)ethyl 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxylate (PubChem CID 55867483) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55867483 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 2-(1-methylpyrazol-4-yl)-1,3-thiazole-4-carboxylate |
| SMILES | Cn1cc(-c2nc(C(=O)OCCOc3ccc(C#N)cc3)cs2)cn1 |
| InChI | InChI=1S/C17H14N4O3S/c1-21-10-13(9-19-21)16-20-15(11-25-16)17(22)24-7-6-23-14-4-2-12(8-18)3-5-14/h2-5,9-11H,6-7H2,1H3 |
| InChIKey | LHEUODAKXMLPOF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|