C15H14N2O3S — CID 43056496
3-cyanopropyl 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 43056496) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-cyanopropyl 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 3-cyanopropyl 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 43056496 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-cyanopropyl 2-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(-c2nc(C(=O)OCCCC#N)cs2)cc1 |
| InChI | InChI=1S/C15H14N2O3S/c1-19-12-6-4-11(5-7-12)14-17-13(10-21-14)15(18)20-9-3-2-8-16/h4-7,10H,2-3,9H2,1H3 |
| InChIKey | XETQOFHBUBJXMQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|