C16H17FN2O2S2 — CID 55870041
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 55870041) has the molecular formula C16H17FN2O2S2 and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55870041 |
| Molecular Formula | C16H17FN2O2S2 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CSCC(=O)Nc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H17FN2O2S2/c1-11-2-7-14(23-11)8-18-15(20)9-22-10-16(21)19-13-5-3-12(17)4-6-13/h2-7H,8-10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | ZHCFJRHUCHSUDU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |