C13H15NO2S2 — CID 86799328
2-(2-methylfuran-3-yl)sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 86799328) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(2-methylfuran-3-yl)sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2-methylfuran-3-yl)sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 86799328 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-(2-methylfuran-3-yl)sulfanyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2ccoc2C)s1 |
| InChI | InChI=1S/C13H15NO2S2/c1-9-3-4-11(18-9)7-14-13(15)8-17-12-5-6-16-10(12)2/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | GBOYINVQEXLTAB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |