C25H28N2O6 — CID 55871767
2-naphthalen-2-yloxy-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]propanehydrazide (PubChem CID 55871767) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]propanehydrazide.
| Compound Name | 2-naphthalen-2-yloxy-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 55871767 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-naphthalen-2-yloxy-N'-[3-(2,3,4-trimethoxyphenyl)propanoyl]propanehydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)C(C)Oc2ccc3ccccc3c2)c(OC)c1OC |
| InChI | InChI=1S/C25H28N2O6/c1-16(33-20-12-9-17-7-5-6-8-19(17)15-20)25(29)27-26-22(28)14-11-18-10-13-21(30-2)24(32-4)23(18)31-3/h5-10,12-13,15-16H,11,14H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | KYOYHAHZWDSWCE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|