C18H25NO5S — CID 55872668
1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one (PubChem CID 55872668) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one.
| Compound Name | 1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one |
|---|---|
| PubChem CID | 55872668 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)CCOCC1CCCO1 |
| InChI | InChI=1S/C18H25NO5S/c1-25(21,22)16-6-7-17-14(12-16)4-2-9-19(17)18(20)8-11-23-13-15-5-3-10-24-15/h6-7,12,15H,2-5,8-11,13H2,1H3 |
| InChIKey | PXUJCTDALIKEJO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|