C25H31N3O5S — CID 55876388
[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone (PubChem CID 55876388) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 55876388 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]-[2-(2-phenylethyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)N2CCCC2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N3O5S/c1-19-9-11-23(28(30)31)18-24(19)34(32,33)26-16-13-21(14-17-26)25(29)27-15-5-8-22(27)12-10-20-6-3-2-4-7-20/h2-4,6-7,9,11,18,21-22H,5,8,10,12-17H2,1H3 |
| InChIKey | OAFAHFBSFQFAOE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|