C21H25N3O5S2 — CID 45281699
(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 45281699) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 45281699 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-[1-(2-methyl-5-nitrophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)N2CCc3sccc3C2C)CC1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-14-3-4-17(24(26)27)13-20(14)31(28,29)22-9-5-16(6-10-22)21(25)23-11-7-19-18(15(23)2)8-12-30-19/h3-4,8,12-13,15-16H,5-7,9-11H2,1-2H3 |
| InChIKey | JUAUKHLDNCAFAF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|