C23H25NO6 — CID 55876680
ethyl 3-(3-methoxyphenyl)-3-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]propanoate (PubChem CID 55876680) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is ethyl 3-(3-methoxyphenyl)-3-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-(3-methoxyphenyl)-3-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 55876680 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | ethyl 3-(3-methoxyphenyl)-3-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C1(C)Cc2ccccc2C(=O)O1)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H25NO6/c1-4-29-20(25)13-19(15-9-7-10-17(12-15)28-3)24-22(27)23(2)14-16-8-5-6-11-18(16)21(26)30-23/h5-12,19H,4,13-14H2,1-3H3,(H,24,27) |
| InChIKey | ZLVBQHKDVMZGCR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |