C20H25NO5 — CID 55992202
ethyl 1-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 55992202) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is ethyl 1-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55992202 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | ethyl 1-[(3-methyl-1-oxo-4H-isochromene-3-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)C2(C)Cc3ccccc3C(=O)O2)CCCCC1 |
| InChI | InChI=1S/C20H25NO5/c1-3-25-18(24)20(11-7-4-8-12-20)21-17(23)19(2)13-14-9-5-6-10-15(14)16(22)26-19/h5-6,9-10H,3-4,7-8,11-13H2,1-2H3,(H,21,23) |
| InChIKey | DCCXQXDVNBJYAO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |