C17H18ClN3O3S — CID 55876832
methyl 2-[[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 55876832) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is methyl 2-[[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55876832 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | methyl 2-[[1-(5-chloro-2-pyridinyl)piperidine-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)C1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H18ClN3O3S/c1-24-17(23)13-6-9-25-16(13)20-15(22)11-4-7-21(8-5-11)14-3-2-12(18)10-19-14/h2-3,6,9-11H,4-5,7-8H2,1H3,(H,20,22) |
| InChIKey | YXXMDOWOWJKGMJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |