C19H21BrClN3O2 — CID 60581329
N-(4-bromo-2-methoxy-6-methylphenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 60581329) has the molecular formula C19H21BrClN3O2 and a molecular weight of 438.75 g/mol. Its IUPAC name is N-(4-bromo-2-methoxy-6-methylphenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-methoxy-6-methylphenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60581329 |
| Molecular Formula | C19H21BrClN3O2 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-(4-bromo-2-methoxy-6-methylphenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | COc1cc(Br)cc(C)c1NC(=O)C1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C19H21BrClN3O2/c1-12-9-14(20)10-16(26-2)18(12)23-19(25)13-5-7-24(8-6-13)17-4-3-15(21)11-22-17/h3-4,9-11,13H,5-8H2,1-2H3,(H,23,25) |
| InChIKey | XMGYKIMNUGXEKQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |