C22H25ClN2O5 — CID 55877884
2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzamide (PubChem CID 55877884) has the molecular formula C22H25ClN2O5 and a molecular weight of 432.90 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55877884 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxy-4-prop-2-enylphenoxy)acetyl]amino]benzamide |
| SMILES | C=CCc1ccc(OCC(=O)Nc2ccc(C(=O)NCCOC)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C22H25ClN2O5/c1-4-5-15-6-9-19(20(12-15)29-3)30-14-21(26)25-16-7-8-17(18(23)13-16)22(27)24-10-11-28-2/h4,6-9,12-13H,1,5,10-11,14H2,2-3H3,(H,24,27)(H,25,26) |
| InChIKey | XUMQZZRWMZNMRE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|