C23H25FN2O2 — CID 55879674
N-cyclohexyl-4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbenzamide (PubChem CID 55879674) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is N-cyclohexyl-4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbenzamide.
| Compound Name | N-cyclohexyl-4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 55879674 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-cyclohexyl-4-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCCCC2)ccc1NC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C23H25FN2O2/c1-16-14-18(23(28)25-20-8-3-2-4-9-20)11-12-21(16)26-22(27)13-10-17-6-5-7-19(24)15-17/h5-7,10-15,20H,2-4,8-9H2,1H3,(H,25,28)(H,26,27)/b13-10+ |
| InChIKey | IVQOFNFHZYSZGZ-JLHYYAGUSA-N |
| XLogP | 4.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|