C23H16ClN3O5S — CID 55882805
N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-chloroquinoline-8-carboxamide (PubChem CID 55882805) has the molecular formula C23H16ClN3O5S and a molecular weight of 481.92 g/mol. Its IUPAC name is N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-chloroquinoline-8-carboxamide.
| Compound Name | N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-chloroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 55882805 |
| Molecular Formula | C23H16ClN3O5S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-6-chloroquinoline-8-carboxamide |
| SMILES | O=C(NCCN1C(=O)SC(=Cc2ccc3c(c2)OCO3)C1=O)c1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C23H16ClN3O5S/c24-15-10-14-2-1-5-25-20(14)16(11-15)21(28)26-6-7-27-22(29)19(33-23(27)30)9-13-3-4-17-18(8-13)32-12-31-17/h1-5,8-11H,6-7,12H2,(H,26,28) |
| InChIKey | JKYLPGSCYOEWHH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|