C20H30ClN3O2 — CID 55883722
1-butanoyl-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]piperidine-3-carboxamide (PubChem CID 55883722) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 1-butanoyl-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-butanoyl-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55883722 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-butanoyl-N-[2-(2-chlorophenyl)-2-(dimethylamino)ethyl]piperidine-3-carboxamide |
| SMILES | CCCC(=O)N1CCCC(C(=O)NCC(c2ccccc2Cl)N(C)C)C1 |
| InChI | InChI=1S/C20H30ClN3O2/c1-4-8-19(25)24-12-7-9-15(14-24)20(26)22-13-18(23(2)3)16-10-5-6-11-17(16)21/h5-6,10-11,15,18H,4,7-9,12-14H2,1-3H3,(H,22,26) |
| InChIKey | NXRNBSFUEMTYPB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |