C18H18F3N3OS — CID 55884147
2-cyclopentylsulfanyl-N'-[2-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide (PubChem CID 55884147) has the molecular formula C18H18F3N3OS and a molecular weight of 381.42 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N'-[2-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide.
| Compound Name | 2-cyclopentylsulfanyl-N'-[2-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 55884147 |
| Molecular Formula | C18H18F3N3OS |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-cyclopentylsulfanyl-N'-[2-(trifluoromethyl)phenyl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ccccc1C(F)(F)F)c1cccnc1SC1CCCC1 |
| InChI | InChI=1S/C18H18F3N3OS/c19-18(20,21)14-9-3-4-10-15(14)23-24-16(25)13-8-5-11-22-17(13)26-12-6-1-2-7-12/h3-5,8-12,23H,1-2,6-7H2,(H,24,25) |
| InChIKey | DCNJJBLHKXRFHF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|