C18H15NO3S2 — CID 55886538
1-benzothiophen-3-ylmethyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 55886538) has the molecular formula C18H15NO3S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | 1-benzothiophen-3-ylmethyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 55886538 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | NC(=O)CSc1ccccc1C(=O)OCc1csc2ccccc12 |
| InChI | InChI=1S/C18H15NO3S2/c19-17(20)11-24-16-8-4-2-6-14(16)18(21)22-9-12-10-23-15-7-3-1-5-13(12)15/h1-8,10H,9,11H2,(H2,19,20) |
| InChIKey | BQBMZDINVKKLDK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |