C17H14F3NO3S — CID 9478432
[4-(trifluoromethyl)phenyl]methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 9478432) has the molecular formula C17H14F3NO3S and a molecular weight of 369.36 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 9478432 |
| Molecular Formula | C17H14F3NO3S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | NC(=O)CSc1ccccc1C(=O)OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO3S/c18-17(19,20)12-7-5-11(6-8-12)9-24-16(23)13-3-1-2-4-14(13)25-10-15(21)22/h1-8H,9-10H2,(H2,21,22) |
| InChIKey | RKVJRWXERXIIHA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |