C21H23NO4S — CID 55443130
[2-(4-butylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 55443130) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is [2-(4-butylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [2-(4-butylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 55443130 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-(4-butylphenyl)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | CCCCc1ccc(C(=O)COC(=O)c2ccccc2SCC(N)=O)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-2-3-6-15-9-11-16(12-10-15)18(23)13-26-21(25)17-7-4-5-8-19(17)27-14-20(22)24/h4-5,7-12H,2-3,6,13-14H2,1H3,(H2,22,24) |
| InChIKey | BDYWGHMRSPRTLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |