About [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate
[2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate (PubChem CID 166212804) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate |
| PubChem CID | 166212804 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate |
| SMILES | CCCCCCc1ccc(C(=O)COC(=O)c2ncccn2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-3-4-5-7-15-8-10-16(11-9-15)17(22)14-24-19(23)18-20-12-6-13-21-18/h6,8-13H,2-5,7,14H2,1H3 |
| InChIKey | XIARQMBIKQHJQN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate?
The IUPAC name of [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate (CID 166212804) is [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate.
What is the SMILES notation for [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate?
The canonical SMILES for [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate is CCCCCCc1ccc(C(=O)COC(=O)c2ncccn2)cc1.
What is the InChIKey of [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate?
The InChIKey is XIARQMBIKQHJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-2-3-4-5-7-15-8-10-16(11-9-15)17(22)14-24-19(23)18-20-12-6-13-21-18/h6,8-13H,2-5,7,14H2,1H3.
What are the key properties of [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate?
[2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate has a molecular weight of 326.40 g/mol, XLogP of 3.64, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-hexylphenyl)-2-oxoethyl] pyrimidine-2-carboxylate is sourced from PubChem (CID 166212804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).