C20H22O5S — CID 18104068
[2-(4-butylphenyl)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 18104068) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is [2-(4-butylphenyl)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(4-butylphenyl)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18104068 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [2-(4-butylphenyl)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CCCCc1ccc(C(=O)COC(=O)c2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H22O5S/c1-3-4-7-15-10-12-16(13-11-15)18(21)14-25-20(22)17-8-5-6-9-19(17)26(2,23)24/h5-6,8-13H,3-4,7,14H2,1-2H3 |
| InChIKey | WMUDFAOQFIOECY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |