C19H20O5S — CID 18081836
[2-oxo-2-(4-propan-2-ylphenyl)ethyl] 2-methylsulfonylbenzoate (PubChem CID 18081836) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18081836 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [2-oxo-2-(4-propan-2-ylphenyl)ethyl] 2-methylsulfonylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)COC(=O)c2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20O5S/c1-13(2)14-8-10-15(11-9-14)17(20)12-24-19(21)16-6-4-5-7-18(16)25(3,22)23/h4-11,13H,12H2,1-3H3 |
| InChIKey | KQSIXOUYHLFISL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |