C23H30N4O5S — CID 55893503
N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide (PubChem CID 55893503) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide.
| Compound Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 55893503 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-(4-methylpiperidin-1-yl)-5-nitrobenzamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)NC(C)c2ccc(S(=O)(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H30N4O5S/c1-16-11-13-26(14-12-16)22-10-7-19(27(29)30)15-21(22)23(28)24-17(2)18-5-8-20(9-6-18)33(31,32)25(3)4/h5-10,15-17H,11-14H2,1-4H3,(H,24,28) |
| InChIKey | XFTRGQLYOMENQK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|