C22H23ClFN3O2 — CID 55897221
N-(2-chloro-4-fluorophenyl)-2-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]benzamide (PubChem CID 55897221) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 55897221 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]benzamide |
| SMILES | O=C(CNc1ccccc1C(=O)Nc1ccc(F)cc1Cl)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C22H23ClFN3O2/c23-17-11-15(24)9-10-19(17)26-22(29)16-3-1-2-4-18(16)25-12-20(28)27-21(13-5-6-13)14-7-8-14/h1-4,9-11,13-14,21,25H,5-8,12H2,(H,26,29)(H,27,28) |
| InChIKey | JOELKMDEGPPAFI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |