C22H25N3O3 — CID 55898144
2-[3-(morpholine-4-carbonyl)anilino]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 55898144) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[3-(morpholine-4-carbonyl)anilino]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[3-(morpholine-4-carbonyl)anilino]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55898144 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[3-(morpholine-4-carbonyl)anilino]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CNc1cccc(C(=O)N2CCOCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-11-25(20-9-4-3-5-10-20)21(26)17-23-19-8-6-7-18(16-19)22(27)24-12-14-28-15-13-24/h2-10,16,23H,1,11-15,17H2 |
| InChIKey | DZISKDGGHDQASU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|