C19H21N3O5S2 — CID 55906470
N-(3-cyano-5-ethylthiophen-2-yl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55906470) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(3-cyano-5-ethylthiophen-2-yl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(3-cyano-5-ethylthiophen-2-yl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55906470 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(3-cyano-5-ethylthiophen-2-yl)-4-methoxy-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C19H21N3O5S2/c1-3-15-10-14(12-20)19(28-15)21-18(23)13-4-5-16(26-2)17(11-13)29(24,25)22-6-8-27-9-7-22/h4-5,10-11H,3,6-9H2,1-2H3,(H,21,23) |
| InChIKey | KJQSIFPYKAFNMN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |