C18H20N2O7S2 — CID 24509379
methyl 5-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate (PubChem CID 24509379) has the molecular formula C18H20N2O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 5-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24509379 |
| Molecular Formula | C18H20N2O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | methyl 5-[(4-methoxy-3-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C18H20N2O7S2/c1-25-13-4-3-12(11-15(13)29(23,24)20-7-9-27-10-8-20)17(21)19-16-6-5-14(28-16)18(22)26-2/h3-6,11H,7-10H2,1-2H3,(H,19,21) |
| InChIKey | DBMAGJLAASDWAK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |