C26H27N3O2S2 — CID 55909325
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(3-phenothiazin-10-ylpropyl)butanamide (PubChem CID 55909325) has the molecular formula C26H27N3O2S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(3-phenothiazin-10-ylpropyl)butanamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(3-phenothiazin-10-ylpropyl)butanamide |
|---|---|
| PubChem CID | 55909325 |
| Molecular Formula | C26H27N3O2S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxo-N-(3-phenothiazin-10-ylpropyl)butanamide |
| SMILES | O=C(CCC(=O)N1CCc2sccc2C1)NCCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C26H27N3O2S2/c30-25(10-11-26(31)28-16-12-22-19(18-28)13-17-32-22)27-14-5-15-29-20-6-1-3-8-23(20)33-24-9-4-2-7-21(24)29/h1-4,6-9,13,17H,5,10-12,14-16,18H2,(H,27,30) |
| InChIKey | OWBIKQSDJTZBLM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|