C21H20FNO2S — CID 55909368
3-[1-(2-fluorophenyl)ethylsulfanylmethyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 55909368) has the molecular formula C21H20FNO2S and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)ethylsulfanylmethyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[1-(2-fluorophenyl)ethylsulfanylmethyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55909368 |
| Molecular Formula | C21H20FNO2S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[1-(2-fluorophenyl)ethylsulfanylmethyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CC(SCc1cccc(C(=O)NCc2ccco2)c1)c1ccccc1F |
| InChI | InChI=1S/C21H20FNO2S/c1-15(19-9-2-3-10-20(19)22)26-14-16-6-4-7-17(12-16)21(24)23-13-18-8-5-11-25-18/h2-12,15H,13-14H2,1H3,(H,23,24) |
| InChIKey | MVOBFPWYMAJNSL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |