C24H25N3O2S — CID 55915258
4-[[4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]methyl]-N-phenylbenzamide (PubChem CID 55915258) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-[[4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 55915258 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-[[4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]methyl]-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(Cc3ccc(C(=O)Nc4ccccc4)cc3)CC2)s1 |
| InChI | InChI=1S/C24H25N3O2S/c1-18-7-12-22(30-18)24(29)27-15-13-26(14-16-27)17-19-8-10-20(11-9-19)23(28)25-21-5-3-2-4-6-21/h2-12H,13-17H2,1H3,(H,25,28) |
| InChIKey | AWCXPRYCKRAYRC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |