C17H24N2O4S — CID 55915492
phenyl 2-[4-(cyclopropylcarbamoyl)piperidin-1-yl]ethanesulfonate (PubChem CID 55915492) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is phenyl 2-[4-(cyclopropylcarbamoyl)piperidin-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[4-(cyclopropylcarbamoyl)piperidin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 55915492 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | phenyl 2-[4-(cyclopropylcarbamoyl)piperidin-1-yl]ethanesulfonate |
| SMILES | O=C(NC1CC1)C1CCN(CCS(=O)(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O4S/c20-17(18-15-6-7-15)14-8-10-19(11-9-14)12-13-24(21,22)23-16-4-2-1-3-5-16/h1-5,14-15H,6-13H2,(H,18,20) |
| InChIKey | BLBRLUXXIJVFBF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|