C20H23NO5S — CID 55915988
methyl 2-[4-[2-(4-methoxyphenyl)sulfanylpropanoylamino]-3-methylphenoxy]acetate (PubChem CID 55915988) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is methyl 2-[4-[2-(4-methoxyphenyl)sulfanylpropanoylamino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[2-(4-methoxyphenyl)sulfanylpropanoylamino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55915988 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl 2-[4-[2-(4-methoxyphenyl)sulfanylpropanoylamino]-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)C(C)Sc2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-13-11-16(26-12-19(22)25-4)7-10-18(13)21-20(23)14(2)27-17-8-5-15(24-3)6-9-17/h5-11,14H,12H2,1-4H3,(H,21,23) |
| InChIKey | WABJMXFYNXAKKH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |