C20H26N2O3S — CID 55917339
4-(tert-butylsulfamoyl)-N-(2,3-dimethylphenyl)-N-methylbenzamide (PubChem CID 55917339) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-N-(2,3-dimethylphenyl)-N-methylbenzamide.
| Compound Name | 4-(tert-butylsulfamoyl)-N-(2,3-dimethylphenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 55917339 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-N-(2,3-dimethylphenyl)-N-methylbenzamide |
| SMILES | Cc1cccc(N(C)C(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C20H26N2O3S/c1-14-8-7-9-18(15(14)2)22(6)19(23)16-10-12-17(13-11-16)26(24,25)21-20(3,4)5/h7-13,21H,1-6H3 |
| InChIKey | JWQIHUZOPOTIKB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |